C10H10F3N5O3 — CID 168601729
2-[[amino-(diaminomethylideneamino)methylidene]amino]-5-(trifluoromethoxy)benzoic acid (PubChem CID 168601729) has the molecular formula C10H10F3N5O3 and a molecular weight of 305.22 g/mol. Its IUPAC name is 2-[[amino-(diaminomethylideneamino)methylidene]amino]-5-(trifluoromethoxy)benzoic acid.
| Compound Name | 2-[[amino-(diaminomethylideneamino)methylidene]amino]-5-(trifluoromethoxy)benzoic acid |
|---|---|
| PubChem CID | 168601729 |
| Molecular Formula | C10H10F3N5O3 |
| Molecular Weight | 305.22 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | 2-[[amino-(diaminomethylideneamino)methylidene]amino]-5-(trifluoromethoxy)benzoic acid |
| SMILES | NC(N)=N/C(N)=N/c1ccc(OC(F)(F)F)cc1C(=O)O |
| InChI | InChI=1S/C10H10F3N5O3/c11-10(12,13)21-4-1-2-6(5(3-4)7(19)20)17-9(16)18-8(14)15/h1-3H,(H,19,20)(H6,14,15,16,17,18) |
| InChIKey | RGFNTDUZJFGXTP-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 149.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.22 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|