C15H14FN5O — CID 168601860
2-(2-benzoyl-4-fluorophenyl)-1-(diaminomethylidene)guanidine (PubChem CID 168601860) has the molecular formula C15H14FN5O and a molecular weight of 299.31 g/mol. Its IUPAC name is 2-(2-benzoyl-4-fluorophenyl)-1-(diaminomethylidene)guanidine.
| Compound Name | 2-(2-benzoyl-4-fluorophenyl)-1-(diaminomethylidene)guanidine |
|---|---|
| PubChem CID | 168601860 |
| Molecular Formula | C15H14FN5O |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 2-(2-benzoyl-4-fluorophenyl)-1-(diaminomethylidene)guanidine |
| SMILES | NC(N)=N/C(N)=N/c1ccc(F)cc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C15H14FN5O/c16-10-6-7-12(20-15(19)21-14(17)18)11(8-10)13(22)9-4-2-1-3-5-9/h1-8H,(H6,17,18,19,20,21) |
| InChIKey | QKJBUDYUBJSMPT-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 119.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|