C15H11ClF3N3O3 — CID 156880888
6-chloro-N-methyl-4-[[2-(trifluoromethoxy)benzoyl]amino]pyridine-3-carboxamide (PubChem CID 156880888) has the molecular formula C15H11ClF3N3O3 and a molecular weight of 373.72 g/mol. Its IUPAC name is 6-chloro-N-methyl-4-[[2-(trifluoromethoxy)benzoyl]amino]pyridine-3-carboxamide.
| Compound Name | 6-chloro-N-methyl-4-[[2-(trifluoromethoxy)benzoyl]amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 156880888 |
| Molecular Formula | C15H11ClF3N3O3 |
| Molecular Weight | 373.72 g/mol |
| Exact Mass | 373.04 |
| IUPAC Name | 6-chloro-N-methyl-4-[[2-(trifluoromethoxy)benzoyl]amino]pyridine-3-carboxamide |
| SMILES | CNC(=O)c1cnc(Cl)cc1NC(=O)c1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C15H11ClF3N3O3/c1-20-13(23)9-7-21-12(16)6-10(9)22-14(24)8-4-2-3-5-11(8)25-15(17,18)19/h2-7H,1H3,(H,20,23)(H,21,22,24) |
| InChIKey | QKVOLMYTBWOFCC-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.72 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|