About 6-chloro-4-[(2,3-dimethoxybenzoyl)amino]-N-(trideuteriomethyl)pyridine-3-carboxamide
6-chloro-4-[(2,3-dimethoxybenzoyl)amino]-N-(trideuteriomethyl)pyridine-3-carboxamide (PubChem CID 156880958) has the molecular formula C16H16ClN3O4
and a molecular weight of 352.79 g/mol. Its IUPAC name is 6-chloro-4-[(2,3-dimethoxybenzoyl)amino]-N-(trideuteriomethyl)pyridine-3-carboxamide.
Molecular Properties
| Compound Name | 6-chloro-4-[(2,3-dimethoxybenzoyl)amino]-N-(trideuteriomethyl)pyridine-3-carboxamide |
| PubChem CID | 156880958 |
| Molecular Formula | C16H16ClN3O4 |
| Molecular Weight | 352.79 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | 6-chloro-4-[(2,3-dimethoxybenzoyl)amino]-N-(trideuteriomethyl)pyridine-3-carboxamide |
| SMILES | [2H]C([2H])([2H])NC(=O)c1cnc(Cl)cc1NC(=O)c1cccc(OC)c1OC |
| InChI | InChI=1S/C16H16ClN3O4/c1-18-15(21)10-8-19-13(17)7-11(10)20-16(22)9-5-4-6-12(23-2)14(9)24-3/h4-8H,1-3H3,(H,18,21)(H,19,20,22)/i1D3 |
| InChIKey | RLFAXUUTOQJZQG-FIBGUPNXSA-N |
| XLogP | 2.36 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.79 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-4-[(2,3-dimethoxybenzoyl)amino]-N-(trideuteriomethyl)pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-4-[(2,3-dimethoxybenzoyl)amino]-N-(trideuteriomethyl)pyridine-3-carboxamide?
The IUPAC name of 6-chloro-4-[(2,3-dimethoxybenzoyl)amino]-N-(trideuteriomethyl)pyridine-3-carboxamide (CID 156880958) is 6-chloro-4-[(2,3-dimethoxybenzoyl)amino]-N-(trideuteriomethyl)pyridine-3-carboxamide.
What is the SMILES notation for 6-chloro-4-[(2,3-dimethoxybenzoyl)amino]-N-(trideuteriomethyl)pyridine-3-carboxamide?
The canonical SMILES for 6-chloro-4-[(2,3-dimethoxybenzoyl)amino]-N-(trideuteriomethyl)pyridine-3-carboxamide is [2H]C([2H])([2H])NC(=O)c1cnc(Cl)cc1NC(=O)c1cccc(OC)c1OC.
What is the InChIKey of 6-chloro-4-[(2,3-dimethoxybenzoyl)amino]-N-(trideuteriomethyl)pyridine-3-carboxamide?
The InChIKey is RLFAXUUTOQJZQG-FIBGUPNXSA-N. The full InChI is InChI=1S/C16H16ClN3O4/c1-18-15(21)10-8-19-13(17)7-11(10)20-16(22)9-5-4-6-12(23-2)14(9)24-3/h4-8H,1-3H3,(H,18,21)(H,19,20,22)/i1D3.
What are the key properties of 6-chloro-4-[(2,3-dimethoxybenzoyl)amino]-N-(trideuteriomethyl)pyridine-3-carboxamide?
6-chloro-4-[(2,3-dimethoxybenzoyl)amino]-N-(trideuteriomethyl)pyridine-3-carboxamide has a molecular weight of 352.79 g/mol, XLogP of 2.36, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-4-[(2,3-dimethoxybenzoyl)amino]-N-(trideuteriomethyl)pyridine-3-carboxamide is sourced from PubChem (CID 156880958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).