C16H16ClN3O4 — CID 156880958
6-chloro-4-[(2,3-dimethoxybenzoyl)amino]-N-(trideuteriomethyl)pyridine-3-carboxamide (PubChem CID 156880958) has the molecular formula C16H16ClN3O4 and a molecular weight of 352.79 g/mol. Its IUPAC name is 6-chloro-4-[(2,3-dimethoxybenzoyl)amino]-N-(trideuteriomethyl)pyridine-3-carboxamide.
| Compound Name | 6-chloro-4-[(2,3-dimethoxybenzoyl)amino]-N-(trideuteriomethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 156880958 |
| Molecular Formula | C16H16ClN3O4 |
| Molecular Weight | 352.79 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | 6-chloro-4-[(2,3-dimethoxybenzoyl)amino]-N-(trideuteriomethyl)pyridine-3-carboxamide |
| SMILES | [2H]C([2H])([2H])NC(=O)c1cnc(Cl)cc1NC(=O)c1cccc(OC)c1OC |
| InChI | InChI=1S/C16H16ClN3O4/c1-18-15(21)10-8-19-13(17)7-11(10)20-16(22)9-5-4-6-12(23-2)14(9)24-3/h4-8H,1-3H3,(H,18,21)(H,19,20,22)/i1D3 |
| InChIKey | RLFAXUUTOQJZQG-FIBGUPNXSA-N |
| XLogP | 2.36 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.79 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|