C15H14ClN3O4 — CID 170556958
3-[[2-chloro-5-(trideuteriomethylcarbamoyl)-4-pyridinyl]amino]-2-methoxybenzoic acid (PubChem CID 170556958) has the molecular formula C15H14ClN3O4 and a molecular weight of 338.77 g/mol. Its IUPAC name is 3-[[2-chloro-5-(trideuteriomethylcarbamoyl)-4-pyridinyl]amino]-2-methoxybenzoic acid.
| Compound Name | 3-[[2-chloro-5-(trideuteriomethylcarbamoyl)-4-pyridinyl]amino]-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 170556958 |
| Molecular Formula | C15H14ClN3O4 |
| Molecular Weight | 338.77 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 3-[[2-chloro-5-(trideuteriomethylcarbamoyl)-4-pyridinyl]amino]-2-methoxybenzoic acid |
| SMILES | [2H]C([2H])([2H])NC(=O)c1cnc(Cl)cc1Nc1cccc(C(=O)O)c1OC |
| InChI | InChI=1S/C15H14ClN3O4/c1-17-14(20)9-7-18-12(16)6-11(9)19-10-5-3-4-8(15(21)22)13(10)23-2/h3-7H,1-2H3,(H,17,20)(H,18,19)(H,21,22)/i1D3 |
| InChIKey | JCDVUCSAMRAMMH-FIBGUPNXSA-N |
| XLogP | 2.55 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.77 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|