C20H18ClFN4O3 — CID 163387350
6-chloro-N-ethoxy-4-[3-(5-fluoro-2-pyridinyl)-2-methoxyanilino]pyridine-3-carboxamide (PubChem CID 163387350) has the molecular formula C20H18ClFN4O3 and a molecular weight of 416.84 g/mol. Its IUPAC name is 6-chloro-N-ethoxy-4-[3-(5-fluoro-2-pyridinyl)-2-methoxyanilino]pyridine-3-carboxamide.
| Compound Name | 6-chloro-N-ethoxy-4-[3-(5-fluoro-2-pyridinyl)-2-methoxyanilino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 163387350 |
| Molecular Formula | C20H18ClFN4O3 |
| Molecular Weight | 416.84 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | 6-chloro-N-ethoxy-4-[3-(5-fluoro-2-pyridinyl)-2-methoxyanilino]pyridine-3-carboxamide |
| SMILES | CCONC(=O)c1cnc(Cl)cc1Nc1cccc(-c2ccc(F)cn2)c1OC |
| InChI | InChI=1S/C20H18ClFN4O3/c1-3-29-26-20(27)14-11-24-18(21)9-17(14)25-16-6-4-5-13(19(16)28-2)15-8-7-12(22)10-23-15/h4-11H,3H2,1-2H3,(H,24,25)(H,26,27) |
| InChIKey | OABXVFSKSSGOQX-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.84 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|