C16H16ClN7O2 — CID 134439018
6-chloro-4-[2-methoxy-3-(1-methyl-1,2,4-triazol-3-yl)anilino]pyridine-3-carbohydrazide (PubChem CID 134439018) has the molecular formula C16H16ClN7O2 and a molecular weight of 373.80 g/mol. Its IUPAC name is 6-chloro-4-[2-methoxy-3-(1-methyl-1,2,4-triazol-3-yl)anilino]pyridine-3-carbohydrazide.
| Compound Name | 6-chloro-4-[2-methoxy-3-(1-methyl-1,2,4-triazol-3-yl)anilino]pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 134439018 |
| Molecular Formula | C16H16ClN7O2 |
| Molecular Weight | 373.80 g/mol |
| Exact Mass | 373.11 |
| IUPAC Name | 6-chloro-4-[2-methoxy-3-(1-methyl-1,2,4-triazol-3-yl)anilino]pyridine-3-carbohydrazide |
| SMILES | COc1c(Nc2cc(Cl)ncc2C(=O)NN)cccc1-c1ncn(C)n1 |
| InChI | InChI=1S/C16H16ClN7O2/c1-24-8-20-15(23-24)9-4-3-5-11(14(9)26-2)21-12-6-13(17)19-7-10(12)16(25)22-18/h3-8H,18H2,1-2H3,(H,19,21)(H,22,25) |
| InChIKey | OXGSBSQEZLGAHD-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 119.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.80 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|