C21H22ClN5O2 — CID 162355190
[6-chloro-4-[2-methoxy-3-(1-methyl-1,2,4-triazol-3-yl)anilino]-3-pyridinyl]-cyclopentylmethanone (PubChem CID 162355190) has the molecular formula C21H22ClN5O2 and a molecular weight of 411.89 g/mol. Its IUPAC name is [6-chloro-4-[2-methoxy-3-(1-methyl-1,2,4-triazol-3-yl)anilino]-3-pyridinyl]-cyclopentylmethanone.
| Compound Name | [6-chloro-4-[2-methoxy-3-(1-methyl-1,2,4-triazol-3-yl)anilino]-3-pyridinyl]-cyclopentylmethanone |
|---|---|
| PubChem CID | 162355190 |
| Molecular Formula | C21H22ClN5O2 |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | [6-chloro-4-[2-methoxy-3-(1-methyl-1,2,4-triazol-3-yl)anilino]-3-pyridinyl]-cyclopentylmethanone |
| SMILES | COc1c(Nc2cc(Cl)ncc2C(=O)C2CCCC2)cccc1-c1ncn(C)n1 |
| InChI | InChI=1S/C21H22ClN5O2/c1-27-12-24-21(26-27)14-8-5-9-16(20(14)29-2)25-17-10-18(22)23-11-15(17)19(28)13-6-3-4-7-13/h5,8-13H,3-4,6-7H2,1-2H3,(H,23,25) |
| InChIKey | HHILBSIGLDNXIQ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|