C17H22ClN5O3 — CID 144625234
6-chloro-4-[3-(hydrazinecarbonyl)-2-methoxyanilino]-N-methylpyridine-3-carboxamide;ethane (PubChem CID 144625234) has the molecular formula C17H22ClN5O3 and a molecular weight of 379.85 g/mol. Its IUPAC name is 6-chloro-4-[3-(hydrazinecarbonyl)-2-methoxyanilino]-N-methylpyridine-3-carboxamide;ethane.
| Compound Name | 6-chloro-4-[3-(hydrazinecarbonyl)-2-methoxyanilino]-N-methylpyridine-3-carboxamide;ethane |
|---|---|
| PubChem CID | 144625234 |
| Molecular Formula | C17H22ClN5O3 |
| Molecular Weight | 379.85 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 6-chloro-4-[3-(hydrazinecarbonyl)-2-methoxyanilino]-N-methylpyridine-3-carboxamide;ethane |
| SMILES | CC.CNC(=O)c1cnc(Cl)cc1Nc1cccc(C(=O)NN)c1OC |
| InChI | InChI=1S/C15H16ClN5O3.C2H6/c1-18-14(22)9-7-19-12(16)6-11(9)20-10-5-3-4-8(13(10)24-2)15(23)21-17;1-2/h3-7H,17H2,1-2H3,(H,18,22)(H,19,20)(H,21,23);1-2H3 |
| InChIKey | REJWHPSQFXVYPL-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 118.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.85 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|