C19H22N6O6 — CID 163387394
2-N-cyclopropyl-4-[3-[(hydroxyamino)carbamoyl]-2-methoxyanilino]-5-N-methoxypyridine-2,5-dicarboxamide (PubChem CID 163387394) has the molecular formula C19H22N6O6 and a molecular weight of 430.42 g/mol. Its IUPAC name is 2-N-cyclopropyl-4-[3-[(hydroxyamino)carbamoyl]-2-methoxyanilino]-5-N-methoxypyridine-2,5-dicarboxamide.
| Compound Name | 2-N-cyclopropyl-4-[3-[(hydroxyamino)carbamoyl]-2-methoxyanilino]-5-N-methoxypyridine-2,5-dicarboxamide |
|---|---|
| PubChem CID | 163387394 |
| Molecular Formula | C19H22N6O6 |
| Molecular Weight | 430.42 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | 2-N-cyclopropyl-4-[3-[(hydroxyamino)carbamoyl]-2-methoxyanilino]-5-N-methoxypyridine-2,5-dicarboxamide |
| SMILES | CONC(=O)c1cnc(C(=O)NC2CC2)cc1Nc1cccc(C(=O)NNO)c1OC |
| InChI | InChI=1S/C19H22N6O6/c1-30-16-11(17(26)23-25-29)4-3-5-13(16)22-14-8-15(19(28)21-10-6-7-10)20-9-12(14)18(27)24-31-2/h3-5,8-10,25,29H,6-7H2,1-2H3,(H,20,22)(H,21,28)(H,23,26)(H,24,27) |
| InChIKey | SZZHRSGGFQJXBE-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 162.94 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.42 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|