C20H24ClN5O5 — CID 90135042
tert-butyl N-[[3-[[2-chloro-5-(methylcarbamoyl)-4-pyridinyl]amino]-2-methoxybenzoyl]amino]carbamate (PubChem CID 90135042) has the molecular formula C20H24ClN5O5 and a molecular weight of 449.90 g/mol. Its IUPAC name is tert-butyl N-[[3-[[2-chloro-5-(methylcarbamoyl)-4-pyridinyl]amino]-2-methoxybenzoyl]amino]carbamate.
| Compound Name | tert-butyl N-[[3-[[2-chloro-5-(methylcarbamoyl)-4-pyridinyl]amino]-2-methoxybenzoyl]amino]carbamate |
|---|---|
| PubChem CID | 90135042 |
| Molecular Formula | C20H24ClN5O5 |
| Molecular Weight | 449.90 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | tert-butyl N-[[3-[[2-chloro-5-(methylcarbamoyl)-4-pyridinyl]amino]-2-methoxybenzoyl]amino]carbamate |
| SMILES | CNC(=O)c1cnc(Cl)cc1Nc1cccc(C(=O)NNC(=O)OC(C)(C)C)c1OC |
| InChI | InChI=1S/C20H24ClN5O5/c1-20(2,3)31-19(29)26-25-18(28)11-7-6-8-13(16(11)30-5)24-14-9-15(21)23-10-12(14)17(27)22-4/h6-10H,1-5H3,(H,22,27)(H,23,24)(H,25,28)(H,26,29) |
| InChIKey | LPSSHFQXPDVHBR-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 130.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.90 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|