C23H28ClN5O5S — CID 163387746
4-[5-chloro-4-cyclopropyl-2-[methyl(methylsulfonyl)amino]anilino]-2-N-cyclopropyl-5-N-ethoxypyridine-2,5-dicarboxamide (PubChem CID 163387746) has the molecular formula C23H28ClN5O5S and a molecular weight of 522.03 g/mol. Its IUPAC name is 4-[5-chloro-4-cyclopropyl-2-[methyl(methylsulfonyl)amino]anilino]-2-N-cyclopropyl-5-N-ethoxypyridine-2,5-dicarboxamide.
| Compound Name | 4-[5-chloro-4-cyclopropyl-2-[methyl(methylsulfonyl)amino]anilino]-2-N-cyclopropyl-5-N-ethoxypyridine-2,5-dicarboxamide |
|---|---|
| PubChem CID | 163387746 |
| Molecular Formula | C23H28ClN5O5S |
| Molecular Weight | 522.03 g/mol |
| Exact Mass | 521.15 |
| IUPAC Name | 4-[5-chloro-4-cyclopropyl-2-[methyl(methylsulfonyl)amino]anilino]-2-N-cyclopropyl-5-N-ethoxypyridine-2,5-dicarboxamide |
| SMILES | CCONC(=O)c1cnc(C(=O)NC2CC2)cc1Nc1cc(Cl)c(C2CC2)cc1N(C)S(C)(=O)=O |
| InChI | InChI=1S/C23H28ClN5O5S/c1-4-34-28-22(30)16-12-25-20(23(31)26-14-7-8-14)11-18(16)27-19-10-17(24)15(13-5-6-13)9-21(19)29(2)35(3,32)33/h9-14H,4-8H2,1-3H3,(H,25,27)(H,26,31)(H,28,30) |
| InChIKey | PWRZOCWVNGLOSS-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 129.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.03 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|