C23H28ClN5O3S — CID 170284981
4-[5-chloro-4-cyclopropyl-2-[methyl(methylsulfanyl)amino]anilino]-6-(cyclopropanecarbonylamino)-N-ethoxypyridine-3-carboxamide (PubChem CID 170284981) has the molecular formula C23H28ClN5O3S and a molecular weight of 490.03 g/mol. Its IUPAC name is 4-[5-chloro-4-cyclopropyl-2-[methyl(methylsulfanyl)amino]anilino]-6-(cyclopropanecarbonylamino)-N-ethoxypyridine-3-carboxamide.
| Compound Name | 4-[5-chloro-4-cyclopropyl-2-[methyl(methylsulfanyl)amino]anilino]-6-(cyclopropanecarbonylamino)-N-ethoxypyridine-3-carboxamide |
|---|---|
| PubChem CID | 170284981 |
| Molecular Formula | C23H28ClN5O3S |
| Molecular Weight | 490.03 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | 4-[5-chloro-4-cyclopropyl-2-[methyl(methylsulfanyl)amino]anilino]-6-(cyclopropanecarbonylamino)-N-ethoxypyridine-3-carboxamide |
| SMILES | CCONC(=O)c1cnc(NC(=O)C2CC2)cc1Nc1cc(Cl)c(C2CC2)cc1N(C)SC |
| InChI | InChI=1S/C23H28ClN5O3S/c1-4-32-28-23(31)16-12-25-21(27-22(30)14-7-8-14)11-18(16)26-19-10-17(24)15(13-5-6-13)9-20(19)29(2)33-3/h9-14H,4-8H2,1-3H3,(H,28,31)(H2,25,26,27,30) |
| InChIKey | CFZKRPOOWZGVNH-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.03 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|