C19H23N5O5S — CID 167101479
6-(cyclopropanecarbonylamino)-N-methoxy-4-[2-[methyl(methylsulfonyl)amino]anilino]pyridine-3-carboxamide (PubChem CID 167101479) has the molecular formula C19H23N5O5S and a molecular weight of 433.49 g/mol. Its IUPAC name is 6-(cyclopropanecarbonylamino)-N-methoxy-4-[2-[methyl(methylsulfonyl)amino]anilino]pyridine-3-carboxamide.
| Compound Name | 6-(cyclopropanecarbonylamino)-N-methoxy-4-[2-[methyl(methylsulfonyl)amino]anilino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 167101479 |
| Molecular Formula | C19H23N5O5S |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | 6-(cyclopropanecarbonylamino)-N-methoxy-4-[2-[methyl(methylsulfonyl)amino]anilino]pyridine-3-carboxamide |
| SMILES | CONC(=O)c1cnc(NC(=O)C2CC2)cc1Nc1ccccc1N(C)S(C)(=O)=O |
| InChI | InChI=1S/C19H23N5O5S/c1-24(30(3,27)28)16-7-5-4-6-14(16)21-15-10-17(22-18(25)12-8-9-12)20-11-13(15)19(26)23-29-2/h4-7,10-12H,8-9H2,1-3H3,(H,23,26)(H2,20,21,22,25) |
| InChIKey | XOXNHJSMZGCUAR-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 129.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|