C19H18N6O4S — CID 170164285
6-(cyclopropanecarbonylamino)-N-methoxy-4-[[2-oxo-1-(1,3-thiazol-2-yl)-3-pyridinyl]amino]pyridine-3-carboxamide (PubChem CID 170164285) has the molecular formula C19H18N6O4S and a molecular weight of 426.46 g/mol. Its IUPAC name is 6-(cyclopropanecarbonylamino)-N-methoxy-4-[[2-oxo-1-(1,3-thiazol-2-yl)-3-pyridinyl]amino]pyridine-3-carboxamide.
| Compound Name | 6-(cyclopropanecarbonylamino)-N-methoxy-4-[[2-oxo-1-(1,3-thiazol-2-yl)-3-pyridinyl]amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 170164285 |
| Molecular Formula | C19H18N6O4S |
| Molecular Weight | 426.46 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | 6-(cyclopropanecarbonylamino)-N-methoxy-4-[[2-oxo-1-(1,3-thiazol-2-yl)-3-pyridinyl]amino]pyridine-3-carboxamide |
| SMILES | CONC(=O)c1cnc(NC(=O)C2CC2)cc1Nc1cccn(-c2nccs2)c1=O |
| InChI | InChI=1S/C19H18N6O4S/c1-29-24-17(27)12-10-21-15(23-16(26)11-4-5-11)9-14(12)22-13-3-2-7-25(18(13)28)19-20-6-8-30-19/h2-3,6-11H,4-5H2,1H3,(H,24,27)(H2,21,22,23,26) |
| InChIKey | FKAPNDUFLOVHDR-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 127.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.46 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|