C19H22FN5O3S — CID 170281274
6-(cyclopropanecarbonylamino)-4-[4-fluoro-2-[methyl(methylsulfanyl)amino]anilino]-N-methoxypyridine-3-carboxamide (PubChem CID 170281274) has the molecular formula C19H22FN5O3S and a molecular weight of 419.48 g/mol. Its IUPAC name is 6-(cyclopropanecarbonylamino)-4-[4-fluoro-2-[methyl(methylsulfanyl)amino]anilino]-N-methoxypyridine-3-carboxamide.
| Compound Name | 6-(cyclopropanecarbonylamino)-4-[4-fluoro-2-[methyl(methylsulfanyl)amino]anilino]-N-methoxypyridine-3-carboxamide |
|---|---|
| PubChem CID | 170281274 |
| Molecular Formula | C19H22FN5O3S |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | 6-(cyclopropanecarbonylamino)-4-[4-fluoro-2-[methyl(methylsulfanyl)amino]anilino]-N-methoxypyridine-3-carboxamide |
| SMILES | CONC(=O)c1cnc(NC(=O)C2CC2)cc1Nc1ccc(F)cc1N(C)SC |
| InChI | InChI=1S/C19H22FN5O3S/c1-25(29-3)16-8-12(20)6-7-14(16)22-15-9-17(23-18(26)11-4-5-11)21-10-13(15)19(27)24-28-2/h6-11H,4-5H2,1-3H3,(H,24,27)(H2,21,22,23,26) |
| InChIKey | OIJGWNOLXAKZAG-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|