C21H27N4O3P — CID 170719834
6-(cyclopropanecarbonylamino)-4-(4-diethylphosphanyl-2-methoxyanilino)pyridine-3-carboxamide (PubChem CID 170719834) has the molecular formula C21H27N4O3P and a molecular weight of 414.45 g/mol. Its IUPAC name is 6-(cyclopropanecarbonylamino)-4-(4-diethylphosphanyl-2-methoxyanilino)pyridine-3-carboxamide.
| Compound Name | 6-(cyclopropanecarbonylamino)-4-(4-diethylphosphanyl-2-methoxyanilino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 170719834 |
| Molecular Formula | C21H27N4O3P |
| Molecular Weight | 414.45 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 6-(cyclopropanecarbonylamino)-4-(4-diethylphosphanyl-2-methoxyanilino)pyridine-3-carboxamide |
| SMILES | CCP(CC)c1ccc(Nc2cc(NC(=O)C3CC3)ncc2C(N)=O)c(OC)c1 |
| InChI | InChI=1S/C21H27N4O3P/c1-4-29(5-2)14-8-9-16(18(10-14)28-3)24-17-11-19(23-12-15(17)20(22)26)25-21(27)13-6-7-13/h8-13H,4-7H2,1-3H3,(H2,22,26)(H2,23,24,25,27) |
| InChIKey | KIFQKCUJELHEJI-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.45 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|