C15H16ClFN4O4S — CID 163387290
6-chloro-4-[4-fluoro-2-[methyl(methylsulfonyl)amino]anilino]-N-methoxypyridine-3-carboxamide (PubChem CID 163387290) has the molecular formula C15H16ClFN4O4S and a molecular weight of 402.84 g/mol. Its IUPAC name is 6-chloro-4-[4-fluoro-2-[methyl(methylsulfonyl)amino]anilino]-N-methoxypyridine-3-carboxamide.
| Compound Name | 6-chloro-4-[4-fluoro-2-[methyl(methylsulfonyl)amino]anilino]-N-methoxypyridine-3-carboxamide |
|---|---|
| PubChem CID | 163387290 |
| Molecular Formula | C15H16ClFN4O4S |
| Molecular Weight | 402.84 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | 6-chloro-4-[4-fluoro-2-[methyl(methylsulfonyl)amino]anilino]-N-methoxypyridine-3-carboxamide |
| SMILES | CONC(=O)c1cnc(Cl)cc1Nc1ccc(F)cc1N(C)S(C)(=O)=O |
| InChI | InChI=1S/C15H16ClFN4O4S/c1-21(26(3,23)24)13-6-9(17)4-5-11(13)19-12-7-14(16)18-8-10(12)15(22)20-25-2/h4-8H,1-3H3,(H,18,19)(H,20,22) |
| InChIKey | QRCCIXSWRGTMCR-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.84 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|