C19H25ClN4O4S — CID 167101548
6-chloro-N-ethoxy-4-[2-[methyl(methylsulfonyl)amino]-4-propan-2-ylanilino]pyridine-3-carboxamide (PubChem CID 167101548) has the molecular formula C19H25ClN4O4S and a molecular weight of 440.95 g/mol. Its IUPAC name is 6-chloro-N-ethoxy-4-[2-[methyl(methylsulfonyl)amino]-4-propan-2-ylanilino]pyridine-3-carboxamide.
| Compound Name | 6-chloro-N-ethoxy-4-[2-[methyl(methylsulfonyl)amino]-4-propan-2-ylanilino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 167101548 |
| Molecular Formula | C19H25ClN4O4S |
| Molecular Weight | 440.95 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | 6-chloro-N-ethoxy-4-[2-[methyl(methylsulfonyl)amino]-4-propan-2-ylanilino]pyridine-3-carboxamide |
| SMILES | CCONC(=O)c1cnc(Cl)cc1Nc1ccc(C(C)C)cc1N(C)S(C)(=O)=O |
| InChI | InChI=1S/C19H25ClN4O4S/c1-6-28-23-19(25)14-11-21-18(20)10-16(14)22-15-8-7-13(12(2)3)9-17(15)24(4)29(5,26)27/h7-12H,6H2,1-5H3,(H,21,22)(H,23,25) |
| InChIKey | NERJMDOTTJMJBI-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.95 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|