C20H22ClN7O4S — CID 163387368
4-[4-chloro-2-[methyl(methylsulfonyl)amino]anilino]-N-ethoxy-6-(pyridazin-3-ylamino)pyridine-3-carboxamide (PubChem CID 163387368) has the molecular formula C20H22ClN7O4S and a molecular weight of 491.96 g/mol. Its IUPAC name is 4-[4-chloro-2-[methyl(methylsulfonyl)amino]anilino]-N-ethoxy-6-(pyridazin-3-ylamino)pyridine-3-carboxamide.
| Compound Name | 4-[4-chloro-2-[methyl(methylsulfonyl)amino]anilino]-N-ethoxy-6-(pyridazin-3-ylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 163387368 |
| Molecular Formula | C20H22ClN7O4S |
| Molecular Weight | 491.96 g/mol |
| Exact Mass | 491.11 |
| IUPAC Name | 4-[4-chloro-2-[methyl(methylsulfonyl)amino]anilino]-N-ethoxy-6-(pyridazin-3-ylamino)pyridine-3-carboxamide |
| SMILES | CCONC(=O)c1cnc(Nc2cccnn2)cc1Nc1ccc(Cl)cc1N(C)S(C)(=O)=O |
| InChI | InChI=1S/C20H22ClN7O4S/c1-4-32-27-20(29)14-12-22-19(25-18-6-5-9-23-26-18)11-16(14)24-15-8-7-13(21)10-17(15)28(2)33(3,30)31/h5-12H,4H2,1-3H3,(H,27,29)(H2,22,24,25,26) |
| InChIKey | VVPZMKWHMHCPLB-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 138.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.96 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|