C20H26ClN5O5S — CID 167101467
6-chloro-N-ethoxy-4-[2-[methyl(methylsulfonyl)amino]-4-morpholin-4-ylanilino]pyridine-3-carboxamide (PubChem CID 167101467) has the molecular formula C20H26ClN5O5S and a molecular weight of 483.98 g/mol. Its IUPAC name is 6-chloro-N-ethoxy-4-[2-[methyl(methylsulfonyl)amino]-4-morpholin-4-ylanilino]pyridine-3-carboxamide.
| Compound Name | 6-chloro-N-ethoxy-4-[2-[methyl(methylsulfonyl)amino]-4-morpholin-4-ylanilino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 167101467 |
| Molecular Formula | C20H26ClN5O5S |
| Molecular Weight | 483.98 g/mol |
| Exact Mass | 483.13 |
| IUPAC Name | 6-chloro-N-ethoxy-4-[2-[methyl(methylsulfonyl)amino]-4-morpholin-4-ylanilino]pyridine-3-carboxamide |
| SMILES | CCONC(=O)c1cnc(Cl)cc1Nc1ccc(N2CCOCC2)cc1N(C)S(C)(=O)=O |
| InChI | InChI=1S/C20H26ClN5O5S/c1-4-31-24-20(27)15-13-22-19(21)12-17(15)23-16-6-5-14(26-7-9-30-10-8-26)11-18(16)25(2)32(3,28)29/h5-6,11-13H,4,7-10H2,1-3H3,(H,22,23)(H,24,27) |
| InChIKey | OQAFEENGARONCB-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 113.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.98 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|