C19H22Cl2N4O4S — CID 163387406
6-chloro-4-[5-chloro-4-cyclopropyl-2-[methyl(methylsulfonyl)amino]anilino]-N-ethoxypyridine-3-carboxamide (PubChem CID 163387406) has the molecular formula C19H22Cl2N4O4S and a molecular weight of 473.38 g/mol. Its IUPAC name is 6-chloro-4-[5-chloro-4-cyclopropyl-2-[methyl(methylsulfonyl)amino]anilino]-N-ethoxypyridine-3-carboxamide.
| Compound Name | 6-chloro-4-[5-chloro-4-cyclopropyl-2-[methyl(methylsulfonyl)amino]anilino]-N-ethoxypyridine-3-carboxamide |
|---|---|
| PubChem CID | 163387406 |
| Molecular Formula | C19H22Cl2N4O4S |
| Molecular Weight | 473.38 g/mol |
| Exact Mass | 472.07 |
| IUPAC Name | 6-chloro-4-[5-chloro-4-cyclopropyl-2-[methyl(methylsulfonyl)amino]anilino]-N-ethoxypyridine-3-carboxamide |
| SMILES | CCONC(=O)c1cnc(Cl)cc1Nc1cc(Cl)c(C2CC2)cc1N(C)S(C)(=O)=O |
| InChI | InChI=1S/C19H22Cl2N4O4S/c1-4-29-24-19(26)13-10-22-18(21)9-15(13)23-16-8-14(20)12(11-5-6-11)7-17(16)25(2)30(3,27)28/h7-11H,4-6H2,1-3H3,(H,22,23)(H,24,26) |
| InChIKey | ONMLYEONECXXQJ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.38 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|