C17H20ClFN4O4S — CID 167101251
6-chloro-N-ethoxy-4-[5-fluoro-4-methyl-2-[methyl(methylsulfonyl)amino]anilino]pyridine-3-carboxamide (PubChem CID 167101251) has the molecular formula C17H20ClFN4O4S and a molecular weight of 430.89 g/mol. Its IUPAC name is 6-chloro-N-ethoxy-4-[5-fluoro-4-methyl-2-[methyl(methylsulfonyl)amino]anilino]pyridine-3-carboxamide.
| Compound Name | 6-chloro-N-ethoxy-4-[5-fluoro-4-methyl-2-[methyl(methylsulfonyl)amino]anilino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 167101251 |
| Molecular Formula | C17H20ClFN4O4S |
| Molecular Weight | 430.89 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | 6-chloro-N-ethoxy-4-[5-fluoro-4-methyl-2-[methyl(methylsulfonyl)amino]anilino]pyridine-3-carboxamide |
| SMILES | CCONC(=O)c1cnc(Cl)cc1Nc1cc(F)c(C)cc1N(C)S(C)(=O)=O |
| InChI | InChI=1S/C17H20ClFN4O4S/c1-5-27-22-17(24)11-9-20-16(18)8-13(11)21-14-7-12(19)10(2)6-15(14)23(3)28(4,25)26/h6-9H,5H2,1-4H3,(H,20,21)(H,22,24) |
| InChIKey | RBQMTVHEAMHNOG-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.89 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|