C23H23FN6O4S — CID 167101509
N-ethoxy-4-[4-ethynyl-2-[methyl(methylsulfonyl)amino]anilino]-6-[(5-fluoro-2-pyridinyl)amino]pyridine-3-carboxamide (PubChem CID 167101509) has the molecular formula C23H23FN6O4S and a molecular weight of 498.54 g/mol. Its IUPAC name is N-ethoxy-4-[4-ethynyl-2-[methyl(methylsulfonyl)amino]anilino]-6-[(5-fluoro-2-pyridinyl)amino]pyridine-3-carboxamide.
| Compound Name | N-ethoxy-4-[4-ethynyl-2-[methyl(methylsulfonyl)amino]anilino]-6-[(5-fluoro-2-pyridinyl)amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 167101509 |
| Molecular Formula | C23H23FN6O4S |
| Molecular Weight | 498.54 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | N-ethoxy-4-[4-ethynyl-2-[methyl(methylsulfonyl)amino]anilino]-6-[(5-fluoro-2-pyridinyl)amino]pyridine-3-carboxamide |
| SMILES | C#Cc1ccc(Nc2cc(Nc3ccc(F)cn3)ncc2C(=O)NOCC)c(N(C)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C23H23FN6O4S/c1-5-15-7-9-18(20(11-15)30(3)35(4,32)33)27-19-12-22(28-21-10-8-16(24)13-25-21)26-14-17(19)23(31)29-34-6-2/h1,7-14H,6H2,2-4H3,(H,29,31)(H2,25,26,27,28) |
| InChIKey | YVZFCMFREYYVDY-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 125.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.54 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|