C25H30F2N6O4S — CID 163387624
N-ethoxy-4-[5-fluoro-2-[methyl(methylsulfonyl)amino]-4-propan-2-ylanilino]-6-[(6-fluoro-2-methyl-3-pyridinyl)amino]pyridine-3-carboxamide (PubChem CID 163387624) has the molecular formula C25H30F2N6O4S and a molecular weight of 548.62 g/mol. Its IUPAC name is N-ethoxy-4-[5-fluoro-2-[methyl(methylsulfonyl)amino]-4-propan-2-ylanilino]-6-[(6-fluoro-2-methyl-3-pyridinyl)amino]pyridine-3-carboxamide.
| Compound Name | N-ethoxy-4-[5-fluoro-2-[methyl(methylsulfonyl)amino]-4-propan-2-ylanilino]-6-[(6-fluoro-2-methyl-3-pyridinyl)amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 163387624 |
| Molecular Formula | C25H30F2N6O4S |
| Molecular Weight | 548.62 g/mol |
| Exact Mass | 548.20 |
| IUPAC Name | N-ethoxy-4-[5-fluoro-2-[methyl(methylsulfonyl)amino]-4-propan-2-ylanilino]-6-[(6-fluoro-2-methyl-3-pyridinyl)amino]pyridine-3-carboxamide |
| SMILES | CCONC(=O)c1cnc(Nc2ccc(F)nc2C)cc1Nc1cc(F)c(C(C)C)cc1N(C)S(C)(=O)=O |
| InChI | InChI=1S/C25H30F2N6O4S/c1-7-37-32-25(34)17-13-28-24(31-19-8-9-23(27)29-15(19)4)12-20(17)30-21-11-18(26)16(14(2)3)10-22(21)33(5)38(6,35)36/h8-14H,7H2,1-6H3,(H,32,34)(H2,28,30,31) |
| InChIKey | IBWAPDSPDOGVIT-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 125.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.62 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|