C23H30N6O3S2 — CID 170281582
4-[4-cyclopropyl-2-[methyl(methylsulfinyl)amino]anilino]-N-ethoxy-6-[[(Z)-2-(methylideneamino)ethenyl]sulfanylmethylamino]pyridine-3-carboxamide (PubChem CID 170281582) has the molecular formula C23H30N6O3S2 and a molecular weight of 502.67 g/mol. Its IUPAC name is 4-[4-cyclopropyl-2-[methyl(methylsulfinyl)amino]anilino]-N-ethoxy-6-[[(Z)-2-(methylideneamino)ethenyl]sulfanylmethylamino]pyridine-3-carboxamide.
| Compound Name | 4-[4-cyclopropyl-2-[methyl(methylsulfinyl)amino]anilino]-N-ethoxy-6-[[(Z)-2-(methylideneamino)ethenyl]sulfanylmethylamino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 170281582 |
| Molecular Formula | C23H30N6O3S2 |
| Molecular Weight | 502.67 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | 4-[4-cyclopropyl-2-[methyl(methylsulfinyl)amino]anilino]-N-ethoxy-6-[[(Z)-2-(methylideneamino)ethenyl]sulfanylmethylamino]pyridine-3-carboxamide |
| SMILES | C=N/C=C\SCNc1cc(Nc2ccc(C3CC3)cc2N(C)S(C)=O)c(C(=O)NOCC)cn1 |
| InChI | InChI=1S/C23H30N6O3S2/c1-5-32-28-23(30)18-14-25-22(26-15-33-11-10-24-2)13-20(18)27-19-9-8-17(16-6-7-16)12-21(19)29(3)34(4)31/h8-14,16H,2,5-7,15H2,1,3-4H3,(H,28,30)(H2,25,26,27)/b11-10- |
| InChIKey | MZVGQYKFOUVIMD-KHPPLWFESA-N |
| XLogP | 4.39 |
| TPSA | 107.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.67 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|