C25H33N7O3S — CID 170285405
6-[(2,6-dimethylpyrimidin-4-yl)amino]-N-ethoxy-4-[2-[methyl(methylsulfanyl)amino]-4-propan-2-yloxyanilino]pyridine-3-carboxamide (PubChem CID 170285405) has the molecular formula C25H33N7O3S and a molecular weight of 511.65 g/mol. Its IUPAC name is 6-[(2,6-dimethylpyrimidin-4-yl)amino]-N-ethoxy-4-[2-[methyl(methylsulfanyl)amino]-4-propan-2-yloxyanilino]pyridine-3-carboxamide.
| Compound Name | 6-[(2,6-dimethylpyrimidin-4-yl)amino]-N-ethoxy-4-[2-[methyl(methylsulfanyl)amino]-4-propan-2-yloxyanilino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 170285405 |
| Molecular Formula | C25H33N7O3S |
| Molecular Weight | 511.65 g/mol |
| Exact Mass | 511.24 |
| IUPAC Name | 6-[(2,6-dimethylpyrimidin-4-yl)amino]-N-ethoxy-4-[2-[methyl(methylsulfanyl)amino]-4-propan-2-yloxyanilino]pyridine-3-carboxamide |
| SMILES | CCONC(=O)c1cnc(Nc2cc(C)nc(C)n2)cc1Nc1ccc(OC(C)C)cc1N(C)SC |
| InChI | InChI=1S/C25H33N7O3S/c1-8-34-31-25(33)19-14-26-23(30-24-11-16(4)27-17(5)28-24)13-21(19)29-20-10-9-18(35-15(2)3)12-22(20)32(6)36-7/h9-15H,8H2,1-7H3,(H,31,33)(H2,26,27,28,29,30) |
| InChIKey | PUARZPCPFLDQGP-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 113.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.65 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|