C24H28N6O4S — CID 170166824
4-[4-cyclopropyl-2-[methyl(sulfino)amino]anilino]-5-(ethoxycarbamoyl)-2-[(6-methyl-2-pyridinyl)amino]pyridine (PubChem CID 170166824) has the molecular formula C24H28N6O4S and a molecular weight of 496.59 g/mol. Its IUPAC name is 4-[4-cyclopropyl-2-[methyl(sulfino)amino]anilino]-5-(ethoxycarbamoyl)-2-[(6-methyl-2-pyridinyl)amino]pyridine.
| Compound Name | 4-[4-cyclopropyl-2-[methyl(sulfino)amino]anilino]-5-(ethoxycarbamoyl)-2-[(6-methyl-2-pyridinyl)amino]pyridine |
|---|---|
| PubChem CID | 170166824 |
| Molecular Formula | C24H28N6O4S |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | 4-[4-cyclopropyl-2-[methyl(sulfino)amino]anilino]-5-(ethoxycarbamoyl)-2-[(6-methyl-2-pyridinyl)amino]pyridine |
| SMILES | CCONC(=O)c1cnc(Nc2cccc(C)n2)cc1Nc1ccc(C2CC2)cc1N(C)S(=O)O |
| InChI | InChI=1S/C24H28N6O4S/c1-4-34-29-24(31)18-14-25-23(28-22-7-5-6-15(2)26-22)13-20(18)27-19-11-10-17(16-8-9-16)12-21(19)30(3)35(32)33/h5-7,10-14,16H,4,8-9H2,1-3H3,(H,29,31)(H,32,33)(H2,25,26,27,28) |
| InChIKey | ZIZVHURARHMVJD-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 128.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|