C22H23FN6O3S — CID 170281451
4-[2-(cyclopropylsulfinylamino)anilino]-N-ethoxy-6-[(6-fluoro-2-pyridinyl)amino]pyridine-3-carboxamide (PubChem CID 170281451) has the molecular formula C22H23FN6O3S and a molecular weight of 470.53 g/mol. Its IUPAC name is 4-[2-(cyclopropylsulfinylamino)anilino]-N-ethoxy-6-[(6-fluoro-2-pyridinyl)amino]pyridine-3-carboxamide.
| Compound Name | 4-[2-(cyclopropylsulfinylamino)anilino]-N-ethoxy-6-[(6-fluoro-2-pyridinyl)amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 170281451 |
| Molecular Formula | C22H23FN6O3S |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | 4-[2-(cyclopropylsulfinylamino)anilino]-N-ethoxy-6-[(6-fluoro-2-pyridinyl)amino]pyridine-3-carboxamide |
| SMILES | CCONC(=O)c1cnc(Nc2cccc(F)n2)cc1Nc1ccccc1NS(=O)C1CC1 |
| InChI | InChI=1S/C22H23FN6O3S/c1-2-32-28-22(30)15-13-24-21(27-20-9-5-8-19(23)26-20)12-18(15)25-16-6-3-4-7-17(16)29-33(31)14-10-11-14/h3-9,12-14,29H,2,10-11H2,1H3,(H,28,30)(H2,24,25,26,27) |
| InChIKey | JUJJEKFVEIWMRI-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 117.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|