C23H21ClN8O3 — CID 163387560
4-[3-(5-chloropyrimidin-2-yl)-2-methoxyanilino]-N-ethoxy-6-(pyrimidin-2-ylamino)pyridine-3-carboxamide (PubChem CID 163387560) has the molecular formula C23H21ClN8O3 and a molecular weight of 492.93 g/mol. Its IUPAC name is 4-[3-(5-chloropyrimidin-2-yl)-2-methoxyanilino]-N-ethoxy-6-(pyrimidin-2-ylamino)pyridine-3-carboxamide.
| Compound Name | 4-[3-(5-chloropyrimidin-2-yl)-2-methoxyanilino]-N-ethoxy-6-(pyrimidin-2-ylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 163387560 |
| Molecular Formula | C23H21ClN8O3 |
| Molecular Weight | 492.93 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | 4-[3-(5-chloropyrimidin-2-yl)-2-methoxyanilino]-N-ethoxy-6-(pyrimidin-2-ylamino)pyridine-3-carboxamide |
| SMILES | CCONC(=O)c1cnc(Nc2ncccn2)cc1Nc1cccc(-c2ncc(Cl)cn2)c1OC |
| InChI | InChI=1S/C23H21ClN8O3/c1-3-35-32-22(33)16-13-27-19(31-23-25-8-5-9-26-23)10-18(16)30-17-7-4-6-15(20(17)34-2)21-28-11-14(24)12-29-21/h4-13H,3H2,1-2H3,(H,32,33)(H2,25,26,27,30,31) |
| InChIKey | QNOAIRLTQSEKOB-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 136.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.93 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|