C23H29N7O3 — CID 170739317
6-(hexanoylamino)-4-[2-methoxy-3-(1-methyl-1,2,4-triazol-3-yl)anilino]-N-methylpyridine-3-carboxamide (PubChem CID 170739317) has the molecular formula C23H29N7O3 and a molecular weight of 451.53 g/mol. Its IUPAC name is 6-(hexanoylamino)-4-[2-methoxy-3-(1-methyl-1,2,4-triazol-3-yl)anilino]-N-methylpyridine-3-carboxamide.
| Compound Name | 6-(hexanoylamino)-4-[2-methoxy-3-(1-methyl-1,2,4-triazol-3-yl)anilino]-N-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 170739317 |
| Molecular Formula | C23H29N7O3 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | 6-(hexanoylamino)-4-[2-methoxy-3-(1-methyl-1,2,4-triazol-3-yl)anilino]-N-methylpyridine-3-carboxamide |
| SMILES | CCCCCC(=O)Nc1cc(Nc2cccc(-c3ncn(C)n3)c2OC)c(C(=O)NC)cn1 |
| InChI | InChI=1S/C23H29N7O3/c1-5-6-7-11-20(31)28-19-12-18(16(13-25-19)23(32)24-2)27-17-10-8-9-15(21(17)33-4)22-26-14-30(3)29-22/h8-10,12-14H,5-7,11H2,1-4H3,(H,24,32)(H2,25,27,28,31) |
| InChIKey | HMLHPNAFEIJXTK-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 123.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|