C23H30N8O3 — CID 170739278
6-(heptanoylamino)-4-[2-methoxy-3-(1-methyl-1,2,4-triazol-3-yl)anilino]-N-methylpyridazine-3-carboxamide (PubChem CID 170739278) has the molecular formula C23H30N8O3 and a molecular weight of 466.55 g/mol. Its IUPAC name is 6-(heptanoylamino)-4-[2-methoxy-3-(1-methyl-1,2,4-triazol-3-yl)anilino]-N-methylpyridazine-3-carboxamide.
| Compound Name | 6-(heptanoylamino)-4-[2-methoxy-3-(1-methyl-1,2,4-triazol-3-yl)anilino]-N-methylpyridazine-3-carboxamide |
|---|---|
| PubChem CID | 170739278 |
| Molecular Formula | C23H30N8O3 |
| Molecular Weight | 466.55 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | 6-(heptanoylamino)-4-[2-methoxy-3-(1-methyl-1,2,4-triazol-3-yl)anilino]-N-methylpyridazine-3-carboxamide |
| SMILES | CCCCCCC(=O)Nc1cc(Nc2cccc(-c3ncn(C)n3)c2OC)c(C(=O)NC)nn1 |
| InChI | InChI=1S/C23H30N8O3/c1-5-6-7-8-12-19(32)27-18-13-17(20(29-28-18)23(33)24-2)26-16-11-9-10-15(21(16)34-4)22-25-14-31(3)30-22/h9-11,13-14H,5-8,12H2,1-4H3,(H,24,33)(H2,26,27,28,32) |
| InChIKey | PGMZEDRZXAEZTC-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 135.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.55 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|