C23H25FN6O4S — CID 175304202
4-[4-cyclopropyl-2-(methanesulfonamido)anilino]-N-ethoxy-6-[(5-fluoro-3-pyridinyl)amino]pyridine-3-carboxamide (PubChem CID 175304202) has the molecular formula C23H25FN6O4S and a molecular weight of 500.56 g/mol. Its IUPAC name is 4-[4-cyclopropyl-2-(methanesulfonamido)anilino]-N-ethoxy-6-[(5-fluoro-3-pyridinyl)amino]pyridine-3-carboxamide.
| Compound Name | 4-[4-cyclopropyl-2-(methanesulfonamido)anilino]-N-ethoxy-6-[(5-fluoro-3-pyridinyl)amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 175304202 |
| Molecular Formula | C23H25FN6O4S |
| Molecular Weight | 500.56 g/mol |
| Exact Mass | 500.16 |
| IUPAC Name | 4-[4-cyclopropyl-2-(methanesulfonamido)anilino]-N-ethoxy-6-[(5-fluoro-3-pyridinyl)amino]pyridine-3-carboxamide |
| SMILES | CCONC(=O)c1cnc(Nc2cncc(F)c2)cc1Nc1ccc(C2CC2)cc1NS(C)(=O)=O |
| InChI | InChI=1S/C23H25FN6O4S/c1-3-34-29-23(31)18-13-26-22(27-17-9-16(24)11-25-12-17)10-20(18)28-19-7-6-15(14-4-5-14)8-21(19)30-35(2,32)33/h6-14,30H,3-5H2,1-2H3,(H,29,31)(H2,26,27,28) |
| InChIKey | HMPFWCAFYXVZSW-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 134.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.56 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|