C26H27ClN8O5 — CID 175492076
[6-[2-[3-[[2-chloro-5-(methylcarbamoyl)-4-pyridinyl]amino]-4-methoxy-5-(1-methyl-1,2,4-triazol-3-yl)phenyl]ethoxymethyl]-2-pyridinyl] carbamate (PubChem CID 175492076) has the molecular formula C26H27ClN8O5 and a molecular weight of 567.01 g/mol. Its IUPAC name is [6-[2-[3-[[2-chloro-5-(methylcarbamoyl)-4-pyridinyl]amino]-4-methoxy-5-(1-methyl-1,2,4-triazol-3-yl)phenyl]ethoxymethyl]-2-pyridinyl] carbamate.
| Compound Name | [6-[2-[3-[[2-chloro-5-(methylcarbamoyl)-4-pyridinyl]amino]-4-methoxy-5-(1-methyl-1,2,4-triazol-3-yl)phenyl]ethoxymethyl]-2-pyridinyl] carbamate |
|---|---|
| PubChem CID | 175492076 |
| Molecular Formula | C26H27ClN8O5 |
| Molecular Weight | 567.01 g/mol |
| Exact Mass | 566.18 |
| IUPAC Name | [6-[2-[3-[[2-chloro-5-(methylcarbamoyl)-4-pyridinyl]amino]-4-methoxy-5-(1-methyl-1,2,4-triazol-3-yl)phenyl]ethoxymethyl]-2-pyridinyl] carbamate |
| SMILES | CNC(=O)c1cnc(Cl)cc1Nc1cc(CCOCc2cccc(OC(N)=O)n2)cc(-c2ncn(C)n2)c1OC |
| InChI | InChI=1S/C26H27ClN8O5/c1-29-25(36)18-12-30-21(27)11-19(18)33-20-10-15(9-17(23(20)38-3)24-31-14-35(2)34-24)7-8-39-13-16-5-4-6-22(32-16)40-26(28)37/h4-6,9-12,14H,7-8,13H2,1-3H3,(H2,28,37)(H,29,36)(H,30,33) |
| InChIKey | HPUJSFXXDZBCNR-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 168.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.01 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|