C15H14F3NO2 — CID 154244905
N-[[4-methoxy-4-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]-phenylmethylidene]hydroxylamine (PubChem CID 154244905) has the molecular formula C15H14F3NO2 and a molecular weight of 297.28 g/mol. Its IUPAC name is N-[[4-methoxy-4-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]-phenylmethylidene]hydroxylamine.
| Compound Name | N-[[4-methoxy-4-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]-phenylmethylidene]hydroxylamine |
|---|---|
| PubChem CID | 154244905 |
| Molecular Formula | C15H14F3NO2 |
| Molecular Weight | 297.28 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | N-[[4-methoxy-4-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]-phenylmethylidene]hydroxylamine |
| SMILES | COC1(C(F)(F)F)C=CC(C(=NO)c2ccccc2)=CC1 |
| InChI | InChI=1S/C15H14F3NO2/c1-21-14(15(16,17)18)9-7-12(8-10-14)13(19-20)11-5-3-2-4-6-11/h2-9,20H,10H2,1H3 |
| InChIKey | ASZOFQWGQRTKBU-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.28 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|