C22H17Cl3F2N2O2 — CID 151790677
N-[[[4-chloro-4-(2,2-dichloro-1,1-difluoroethoxy)cyclohexa-1,5-dien-1-yl]-phenylmethylidene]amino]benzamide (PubChem CID 151790677) has the molecular formula C22H17Cl3F2N2O2 and a molecular weight of 485.75 g/mol. Its IUPAC name is N-[[[4-chloro-4-(2,2-dichloro-1,1-difluoroethoxy)cyclohexa-1,5-dien-1-yl]-phenylmethylidene]amino]benzamide.
| Compound Name | N-[[[4-chloro-4-(2,2-dichloro-1,1-difluoroethoxy)cyclohexa-1,5-dien-1-yl]-phenylmethylidene]amino]benzamide |
|---|---|
| PubChem CID | 151790677 |
| Molecular Formula | C22H17Cl3F2N2O2 |
| Molecular Weight | 485.75 g/mol |
| Exact Mass | 484.03 |
| IUPAC Name | N-[[[4-chloro-4-(2,2-dichloro-1,1-difluoroethoxy)cyclohexa-1,5-dien-1-yl]-phenylmethylidene]amino]benzamide |
| SMILES | O=C(NN=C(C1=CCC(Cl)(OC(F)(F)C(Cl)Cl)C=C1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H17Cl3F2N2O2/c23-20(24)22(26,27)31-21(25)13-11-16(12-14-21)18(15-7-3-1-4-8-15)28-29-19(30)17-9-5-2-6-10-17/h1-13,20H,14H2,(H,29,30) |
| InChIKey | RWOABQCASFBZRC-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.75 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|