C21H16N2O5 — CID 139929758
4-[[bis(2-hydroxyphenyl)methylideneamino]carbamoyl]benzoic acid (PubChem CID 139929758) has the molecular formula C21H16N2O5 and a molecular weight of 376.37 g/mol. Its IUPAC name is 4-[[bis(2-hydroxyphenyl)methylideneamino]carbamoyl]benzoic acid.
| Compound Name | 4-[[bis(2-hydroxyphenyl)methylideneamino]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 139929758 |
| Molecular Formula | C21H16N2O5 |
| Molecular Weight | 376.37 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 4-[[bis(2-hydroxyphenyl)methylideneamino]carbamoyl]benzoic acid |
| SMILES | O=C(O)c1ccc(C(=O)NN=C(c2ccccc2O)c2ccccc2O)cc1 |
| InChI | InChI=1S/C21H16N2O5/c24-17-7-3-1-5-15(17)19(16-6-2-4-8-18(16)25)22-23-20(26)13-9-11-14(12-10-13)21(27)28/h1-12,24-25H,(H,23,26)(H,27,28) |
| InChIKey | HLGPALMCVFYVIM-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 119.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.37 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|