C21H18N2O3 — CID 135683679
N-[(E)-1-(2,5-dihydroxyphenyl)ethylideneamino]-4-phenylbenzamide (PubChem CID 135683679) has the molecular formula C21H18N2O3 and a molecular weight of 346.39 g/mol. Its IUPAC name is N-[(E)-1-(2,5-dihydroxyphenyl)ethylideneamino]-4-phenylbenzamide.
| Compound Name | N-[(E)-1-(2,5-dihydroxyphenyl)ethylideneamino]-4-phenylbenzamide |
|---|---|
| PubChem CID | 135683679 |
| Molecular Formula | C21H18N2O3 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | N-[(E)-1-(2,5-dihydroxyphenyl)ethylideneamino]-4-phenylbenzamide |
| SMILES | C/C(=N\NC(=O)c1ccc(-c2ccccc2)cc1)c1cc(O)ccc1O |
| InChI | InChI=1S/C21H18N2O3/c1-14(19-13-18(24)11-12-20(19)25)22-23-21(26)17-9-7-16(8-10-17)15-5-3-2-4-6-15/h2-13,24-25H,1H3,(H,23,26)/b22-14+ |
| InChIKey | DMCKAJRNQWLHNV-HYARGMPZSA-N |
| XLogP | 3.92 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|