C24H22N4O4 — CID 135656933
1-N,3-N-bis[(E)-1-(2-hydroxyphenyl)ethylideneamino]benzene-1,3-dicarboxamide (PubChem CID 135656933) has the molecular formula C24H22N4O4 and a molecular weight of 430.46 g/mol. Its IUPAC name is 1-N,3-N-bis[(E)-1-(2-hydroxyphenyl)ethylideneamino]benzene-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis[(E)-1-(2-hydroxyphenyl)ethylideneamino]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 135656933 |
| Molecular Formula | C24H22N4O4 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | 1-N,3-N-bis[(E)-1-(2-hydroxyphenyl)ethylideneamino]benzene-1,3-dicarboxamide |
| SMILES | C/C(=N\NC(=O)c1cccc(C(=O)N/N=C(\C)c2ccccc2O)c1)c1ccccc1O |
| InChI | InChI=1S/C24H22N4O4/c1-15(19-10-3-5-12-21(19)29)25-27-23(31)17-8-7-9-18(14-17)24(32)28-26-16(2)20-11-4-6-13-22(20)30/h3-14,29-30H,1-2H3,(H,27,31)(H,28,32)/b25-15+,26-16+ |
| InChIKey | ZXCGXJQEBLYHNS-RYQLWAFASA-N |
| XLogP | 3.41 |
| TPSA | 123.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|