C23H21N5O4 — CID 135699182
2-N,5-N-bis[(Z)-1-(2-hydroxyphenyl)ethylideneamino]pyridine-2,5-dicarboxamide (PubChem CID 135699182) has the molecular formula C23H21N5O4 and a molecular weight of 431.45 g/mol. Its IUPAC name is 2-N,5-N-bis[(Z)-1-(2-hydroxyphenyl)ethylideneamino]pyridine-2,5-dicarboxamide.
| Compound Name | 2-N,5-N-bis[(Z)-1-(2-hydroxyphenyl)ethylideneamino]pyridine-2,5-dicarboxamide |
|---|---|
| PubChem CID | 135699182 |
| Molecular Formula | C23H21N5O4 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | 2-N,5-N-bis[(Z)-1-(2-hydroxyphenyl)ethylideneamino]pyridine-2,5-dicarboxamide |
| SMILES | C/C(=N/NC(=O)c1ccc(C(=O)N/N=C(/C)c2ccccc2O)nc1)c1ccccc1O |
| InChI | InChI=1S/C23H21N5O4/c1-14(17-7-3-5-9-20(17)29)25-27-22(31)16-11-12-19(24-13-16)23(32)28-26-15(2)18-8-4-6-10-21(18)30/h3-13,29-30H,1-2H3,(H,27,31)(H,28,32)/b25-14-,26-15- |
| InChIKey | YNMFWMZNXDUSHR-CPZPTNFUSA-N |
| XLogP | 2.80 |
| TPSA | 136.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|