C24H18N2O3 — CID 135853166
N-[(Z)-[(2,4-dihydroxyphenyl)-phenylmethylidene]amino]naphthalene-2-carboxamide (PubChem CID 135853166) has the molecular formula C24H18N2O3 and a molecular weight of 382.42 g/mol. Its IUPAC name is N-[(Z)-[(2,4-dihydroxyphenyl)-phenylmethylidene]amino]naphthalene-2-carboxamide.
| Compound Name | N-[(Z)-[(2,4-dihydroxyphenyl)-phenylmethylidene]amino]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 135853166 |
| Molecular Formula | C24H18N2O3 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | N-[(Z)-[(2,4-dihydroxyphenyl)-phenylmethylidene]amino]naphthalene-2-carboxamide |
| SMILES | O=C(N/N=C(/c1ccccc1)c1ccc(O)cc1O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C24H18N2O3/c27-20-12-13-21(22(28)15-20)23(17-7-2-1-3-8-17)25-26-24(29)19-11-10-16-6-4-5-9-18(16)14-19/h1-15,27-28H,(H,26,29)/b25-23- |
| InChIKey | CBKDMCZBZREBRZ-BZZOAKBMSA-N |
| XLogP | 4.43 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|