C10H9BrF2N2O — CID 167523986
N-[(E)-(1-bromo-1,1-difluoropropan-2-ylidene)amino]benzamide (PubChem CID 167523986) has the molecular formula C10H9BrF2N2O and a molecular weight of 291.10 g/mol. Its IUPAC name is N-[(E)-(1-bromo-1,1-difluoropropan-2-ylidene)amino]benzamide.
| Compound Name | N-[(E)-(1-bromo-1,1-difluoropropan-2-ylidene)amino]benzamide |
|---|---|
| PubChem CID | 167523986 |
| Molecular Formula | C10H9BrF2N2O |
| Molecular Weight | 291.10 g/mol |
| Exact Mass | 289.99 |
| IUPAC Name | N-[(E)-(1-bromo-1,1-difluoropropan-2-ylidene)amino]benzamide |
| SMILES | C/C(=N\NC(=O)c1ccccc1)C(F)(F)Br |
| InChI | InChI=1S/C10H9BrF2N2O/c1-7(10(11,12)13)14-15-9(16)8-5-3-2-4-6-8/h2-6H,1H3,(H,15,16)/b14-7+ |
| InChIKey | QAUBPMRMAIBBGZ-VGOFMYFVSA-N |
| XLogP | 2.78 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.10 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|