C18H16CoF6N6O2 — CID 50896973
cobalt;bis(N-(1,1,1-trifluoropropan-2-ylideneamino)pyridine-4-carboxamide) (PubChem CID 50896973) has the molecular formula C18H16CoF6N6O2 and a molecular weight of 521.29 g/mol. Its IUPAC name is cobalt;bis(N-(1,1,1-trifluoropropan-2-ylideneamino)pyridine-4-carboxamide).
| Compound Name | cobalt;bis(N-(1,1,1-trifluoropropan-2-ylideneamino)pyridine-4-carboxamide) |
|---|---|
| PubChem CID | 50896973 |
| Molecular Formula | C18H16CoF6N6O2 |
| Molecular Weight | 521.29 g/mol |
| Exact Mass | 521.06 |
| IUPAC Name | cobalt;bis(N-(1,1,1-trifluoropropan-2-ylideneamino)pyridine-4-carboxamide) |
| SMILES | CC(=NNC(=O)c1ccncc1)C(F)(F)F.CC(=NNC(=O)c1ccncc1)C(F)(F)F.[Co] |
| InChI | InChI=1S/2C9H8F3N3O.Co/c2*1-6(9(10,11)12)14-15-8(16)7-2-4-13-5-3-7;/h2*2-5H,1H3,(H,15,16); |
| InChIKey | RXQSSYSNXKQVMI-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 108.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.29 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|