C14H10F3N3O2S — CID 6391535
N-[(E)-(4,4,4-trifluoro-3-oxo-1-thiophen-2-ylbutylidene)amino]pyridine-4-carboxamide (PubChem CID 6391535) has the molecular formula C14H10F3N3O2S and a molecular weight of 341.31 g/mol. Its IUPAC name is N-[(E)-(4,4,4-trifluoro-3-oxo-1-thiophen-2-ylbutylidene)amino]pyridine-4-carboxamide.
| Compound Name | N-[(E)-(4,4,4-trifluoro-3-oxo-1-thiophen-2-ylbutylidene)amino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 6391535 |
| Molecular Formula | C14H10F3N3O2S |
| Molecular Weight | 341.31 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | N-[(E)-(4,4,4-trifluoro-3-oxo-1-thiophen-2-ylbutylidene)amino]pyridine-4-carboxamide |
| SMILES | O=C(N/N=C(\CC(=O)C(F)(F)F)c1cccs1)c1ccncc1 |
| InChI | InChI=1S/C14H10F3N3O2S/c15-14(16,17)12(21)8-10(11-2-1-7-23-11)19-20-13(22)9-3-5-18-6-4-9/h1-7H,8H2,(H,20,22)/b19-10+ |
| InChIKey | ZOGTVDIQAVZLKB-VXLYETTFSA-N |
| XLogP | 2.80 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.31 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|