C7H5F3N2OS — CID 177392116
N-[(E)-2,2,2-trifluoroethylideneamino]thiophene-2-carboxamide (PubChem CID 177392116) has the molecular formula C7H5F3N2OS and a molecular weight of 222.19 g/mol. Its IUPAC name is N-[(E)-2,2,2-trifluoroethylideneamino]thiophene-2-carboxamide.
| Compound Name | N-[(E)-2,2,2-trifluoroethylideneamino]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 177392116 |
| Molecular Formula | C7H5F3N2OS |
| Molecular Weight | 222.19 g/mol |
| Exact Mass | 222.01 |
| IUPAC Name | N-[(E)-2,2,2-trifluoroethylideneamino]thiophene-2-carboxamide |
| SMILES | O=C(N/N=C/C(F)(F)F)c1cccs1 |
| InChI | InChI=1S/C7H5F3N2OS/c8-7(9,10)4-11-12-6(13)5-2-1-3-14-5/h1-4H,(H,12,13)/b11-4+ |
| InChIKey | PPKQTRPCAKAKGA-NYYWCZLTSA-N |
| XLogP | 2.03 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.19 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|