C10H8ClF3N2O — CID 59956653
4-chloro-N-[(Z)-1,1,1-trifluoropropan-2-ylideneamino]benzamide (PubChem CID 59956653) has the molecular formula C10H8ClF3N2O and a molecular weight of 264.63 g/mol. Its IUPAC name is 4-chloro-N-[(Z)-1,1,1-trifluoropropan-2-ylideneamino]benzamide.
| Compound Name | 4-chloro-N-[(Z)-1,1,1-trifluoropropan-2-ylideneamino]benzamide |
|---|---|
| PubChem CID | 59956653 |
| Molecular Formula | C10H8ClF3N2O |
| Molecular Weight | 264.63 g/mol |
| Exact Mass | 264.03 |
| IUPAC Name | 4-chloro-N-[(Z)-1,1,1-trifluoropropan-2-ylideneamino]benzamide |
| SMILES | C/C(=N/NC(=O)c1ccc(Cl)cc1)C(F)(F)F |
| InChI | InChI=1S/C10H8ClF3N2O/c1-6(10(12,13)14)15-16-9(17)7-2-4-8(11)5-3-7/h2-5H,1H3,(H,16,17)/b15-6- |
| InChIKey | DRCYGEIZBFKGFF-UUASQNMZSA-N |
| XLogP | 3.01 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.63 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|