C10H11ClN2O4 — CID 139076387
(2E)-2-[(4-chlorobenzoyl)hydrazinylidene]propanoic acid;hydrate (PubChem CID 139076387) has the molecular formula C10H11ClN2O4 and a molecular weight of 258.66 g/mol. Its IUPAC name is (2E)-2-[(4-chlorobenzoyl)hydrazinylidene]propanoic acid;hydrate.
| Compound Name | (2E)-2-[(4-chlorobenzoyl)hydrazinylidene]propanoic acid;hydrate |
|---|---|
| PubChem CID | 139076387 |
| Molecular Formula | C10H11ClN2O4 |
| Molecular Weight | 258.66 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | (2E)-2-[(4-chlorobenzoyl)hydrazinylidene]propanoic acid;hydrate |
| SMILES | C/C(=N\NC(=O)c1ccc(Cl)cc1)C(=O)O.O |
| InChI | InChI=1S/C10H9ClN2O3.H2O/c1-6(10(15)16)12-13-9(14)7-2-4-8(11)5-3-7;/h2-5H,1H3,(H,13,14)(H,15,16);1H2/b12-6+; |
| InChIKey | KRUTZKLJECYDSE-WXIWBVQFSA-N |
| XLogP | 0.71 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.66 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|