C30H46N2O — CID 142032372
1-(4-heptoxy-4-methylcyclohexa-1,5-dien-1-yl)-1-phenyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)methanimine (PubChem CID 142032372) has the molecular formula C30H46N2O and a molecular weight of 450.71 g/mol. Its IUPAC name is 1-(4-heptoxy-4-methylcyclohexa-1,5-dien-1-yl)-1-phenyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)methanimine.
| Compound Name | 1-(4-heptoxy-4-methylcyclohexa-1,5-dien-1-yl)-1-phenyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)methanimine |
|---|---|
| PubChem CID | 142032372 |
| Molecular Formula | C30H46N2O |
| Molecular Weight | 450.71 g/mol |
| Exact Mass | 450.36 |
| IUPAC Name | 1-(4-heptoxy-4-methylcyclohexa-1,5-dien-1-yl)-1-phenyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)methanimine |
| SMILES | CCCCCCCOC1(C)C=CC(/C(=N/C2CC(C)(C)NC(C)(C)C2)c2ccccc2)=CC1 |
| InChI | InChI=1S/C30H46N2O/c1-7-8-9-10-14-21-33-30(6)19-17-25(18-20-30)27(24-15-12-11-13-16-24)31-26-22-28(2,3)32-29(4,5)23-26/h11-13,15-19,26,32H,7-10,14,20-23H2,1-6H3/b31-27+ |
| InChIKey | PODVUYPWIOZCKU-TVKQRKNISA-N |
| XLogP | 7.42 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.71 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|