C17H25NO — CID 89240552
2,2,6,6-tetramethyl-4-(1-phenylethenoxy)piperidine (PubChem CID 89240552) has the molecular formula C17H25NO and a molecular weight of 259.39 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-4-(1-phenylethenoxy)piperidine.
| Compound Name | 2,2,6,6-tetramethyl-4-(1-phenylethenoxy)piperidine |
|---|---|
| PubChem CID | 89240552 |
| Molecular Formula | C17H25NO |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | 2,2,6,6-tetramethyl-4-(1-phenylethenoxy)piperidine |
| SMILES | C=C(OC1CC(C)(C)NC(C)(C)C1)c1ccccc1 |
| InChI | InChI=1S/C17H25NO/c1-13(14-9-7-6-8-10-14)19-15-11-16(2,3)18-17(4,5)12-15/h6-10,15,18H,1,11-12H2,2-5H3 |
| InChIKey | OMFAJSQPPRMWLD-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|