About 1-pentoxypentane;1-phenylethenylbenzene
1-pentoxypentane;1-phenylethenylbenzene (PubChem CID 174459575) has the molecular formula C24H34O
and a molecular weight of 338.54 g/mol. Its IUPAC name is 1-pentoxypentane;1-phenylethenylbenzene.
Molecular Properties
| Compound Name | 1-pentoxypentane;1-phenylethenylbenzene |
| PubChem CID | 174459575 |
| Molecular Formula | C24H34O |
| Molecular Weight | 338.54 g/mol |
| Exact Mass | 338.26 |
| IUPAC Name | 1-pentoxypentane;1-phenylethenylbenzene |
| SMILES | C=C(c1ccccc1)c1ccccc1.CCCCCOCCCCC |
| InChI | InChI=1S/C14H12.C10H22O/c1-12(13-8-4-2-5-9-13)14-10-6-3-7-11-14;1-3-5-7-9-11-10-8-6-4-2/h2-11H,1H2;3-10H2,1-2H3 |
| InChIKey | XSOPYWPXTNHGIO-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.54 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-pentoxypentane;1-phenylethenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pentoxypentane;1-phenylethenylbenzene?
The IUPAC name of 1-pentoxypentane;1-phenylethenylbenzene (CID 174459575) is 1-pentoxypentane;1-phenylethenylbenzene.
What is the SMILES notation for 1-pentoxypentane;1-phenylethenylbenzene?
The canonical SMILES for 1-pentoxypentane;1-phenylethenylbenzene is C=C(c1ccccc1)c1ccccc1.CCCCCOCCCCC.
What is the InChIKey of 1-pentoxypentane;1-phenylethenylbenzene?
The InChIKey is XSOPYWPXTNHGIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12.C10H22O/c1-12(13-8-4-2-5-9-13)14-10-6-3-7-11-14;1-3-5-7-9-11-10-8-6-4-2/h2-11H,1H2;3-10H2,1-2H3.
What are the key properties of 1-pentoxypentane;1-phenylethenylbenzene?
1-pentoxypentane;1-phenylethenylbenzene has a molecular weight of 338.54 g/mol, XLogP of 7.13, 10 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pentoxypentane;1-phenylethenylbenzene is sourced from PubChem (CID 174459575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).